C22H34N2O6 — CID 171321505
(3R,4S)-4-benzyl-3-hydroxy-1-(2-methyl-2-morpholin-4-ylpropyl)piperidine-4-carboxylic acid;formic acid (PubChem CID 171321505) has the molecular formula C22H34N2O6 and a molecular weight of 422.52 g/mol. Its IUPAC name is (3R,4S)-4-benzyl-3-hydroxy-1-(2-methyl-2-morpholin-4-ylpropyl)piperidine-4-carboxylic acid;formic acid.
| Compound Name | (3R,4S)-4-benzyl-3-hydroxy-1-(2-methyl-2-morpholin-4-ylpropyl)piperidine-4-carboxylic acid;formic acid |
|---|---|
| PubChem CID | 171321505 |
| Molecular Formula | C22H34N2O6 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | (3R,4S)-4-benzyl-3-hydroxy-1-(2-methyl-2-morpholin-4-ylpropyl)piperidine-4-carboxylic acid;formic acid |
| SMILES | CC(C)(CN1CC[C@](Cc2ccccc2)(C(=O)O)[C@@H](O)C1)N1CCOCC1.O=CO |
| InChI | InChI=1S/C21H32N2O4.CH2O2/c1-20(2,23-10-12-27-13-11-23)16-22-9-8-21(19(25)26,18(24)15-22)14-17-6-4-3-5-7-17;2-1-3/h3-7,18,24H,8-16H2,1-2H3,(H,25,26);1H,(H,2,3)/t18-,21+;/m0./s1 |
| InChIKey | GGYCYNZGKATZKS-OZYANKIXSA-N |
| XLogP | 1.18 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|