C21H23NO4S — CID 135107704
(3S,4S)-4-benzyl-3-hydroxy-1-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]piperidine-4-carboxylic acid (PubChem CID 135107704) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is (3S,4S)-4-benzyl-3-hydroxy-1-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]piperidine-4-carboxylic acid.
| Compound Name | (3S,4S)-4-benzyl-3-hydroxy-1-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 135107704 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | (3S,4S)-4-benzyl-3-hydroxy-1-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)[C@@]1(Cc2ccccc2)CCN(Cc2cc(C#CCO)cs2)C[C@H]1O |
| InChI | InChI=1S/C21H23NO4S/c23-10-4-7-17-11-18(27-15-17)13-22-9-8-21(20(25)26,19(24)14-22)12-16-5-2-1-3-6-16/h1-3,5-6,11,15,19,23-24H,8-10,12-14H2,(H,25,26)/t19-,21-/m1/s1 |
| InChIKey | QWJZILNROROCKR-TZIWHRDSSA-N |
| XLogP | 1.97 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|