C16H19NO4S — CID 137343490
(3aR,7aR)-2-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 137343490) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is (3aR,7aR)-2-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aR,7aR)-2-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 137343490 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (3aR,7aR)-2-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | O=C(O)[C@]12CCOC[C@H]1CN(Cc1cc(C#CCO)cs1)C2 |
| InChI | InChI=1S/C16H19NO4S/c18-4-1-2-12-6-14(22-10-12)8-17-7-13-9-21-5-3-16(13,11-17)15(19)20/h6,10,13,18H,3-5,7-9,11H2,(H,19,20)/t13-,16+/m1/s1 |
| InChIKey | OLIAIOYVXHAGQG-CJNGLKHVSA-N |
| XLogP | 1.01 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|