About 3-[5-(spiro[azepane-4,2'-chromene]-1-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol
3-[5-(spiro[azepane-4,2'-chromene]-1-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol (PubChem CID 50962193) has the molecular formula C22H23NO2S
and a molecular weight of 365.50 g/mol. Its IUPAC name is 3-[5-(spiro[azepane-4,2'-chromene]-1-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol.
Molecular Properties
| Compound Name | 3-[5-(spiro[azepane-4,2'-chromene]-1-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol |
| PubChem CID | 50962193 |
| Molecular Formula | C22H23NO2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 3-[5-(spiro[azepane-4,2'-chromene]-1-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol |
| SMILES | OCC#Cc1csc(CN2CCCC3(C=Cc4ccccc4O3)CC2)c1 |
| InChI | InChI=1S/C22H23NO2S/c24-14-3-5-18-15-20(26-17-18)16-23-12-4-9-22(11-13-23)10-8-19-6-1-2-7-21(19)25-22/h1-2,6-8,10,15,17,24H,4,9,11-14,16H2 |
| InChIKey | BIEWXULVHWHNMY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-(spiro[azepane-4,2'-chromene]-1-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(spiro[azepane-4,2'-chromene]-1-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol?
The IUPAC name of 3-[5-(spiro[azepane-4,2'-chromene]-1-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol (CID 50962193) is 3-[5-(spiro[azepane-4,2'-chromene]-1-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol.
What is the SMILES notation for 3-[5-(spiro[azepane-4,2'-chromene]-1-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol?
The canonical SMILES for 3-[5-(spiro[azepane-4,2'-chromene]-1-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol is OCC#Cc1csc(CN2CCCC3(C=Cc4ccccc4O3)CC2)c1.
What is the InChIKey of 3-[5-(spiro[azepane-4,2'-chromene]-1-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol?
The InChIKey is BIEWXULVHWHNMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23NO2S/c24-14-3-5-18-15-20(26-17-18)16-23-12-4-9-22(11-13-23)10-8-19-6-1-2-7-21(19)25-22/h1-2,6-8,10,15,17,24H,4,9,11-14,16H2.
What are the key properties of 3-[5-(spiro[azepane-4,2'-chromene]-1-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol?
3-[5-(spiro[azepane-4,2'-chromene]-1-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol has a molecular weight of 365.50 g/mol, XLogP of 3.92, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(spiro[azepane-4,2'-chromene]-1-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol is sourced from PubChem (CID 50962193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).