C17H23N3O2 — CID 131935019
(1R,6R)-6-[[2-[benzyl(methyl)amino]acetyl]amino]cyclohex-3-ene-1-carboxamide (PubChem CID 131935019) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is (1R,6R)-6-[[2-[benzyl(methyl)amino]acetyl]amino]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1R,6R)-6-[[2-[benzyl(methyl)amino]acetyl]amino]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 131935019 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (1R,6R)-6-[[2-[benzyl(methyl)amino]acetyl]amino]cyclohex-3-ene-1-carboxamide |
| SMILES | CN(CC(=O)N[C@@H]1CC=CC[C@H]1C(N)=O)Cc1ccccc1 |
| InChI | InChI=1S/C17H23N3O2/c1-20(11-13-7-3-2-4-8-13)12-16(21)19-15-10-6-5-9-14(15)17(18)22/h2-8,14-15H,9-12H2,1H3,(H2,18,22)(H,19,21)/t14-,15-/m1/s1 |
| InChIKey | JMCGRNCPZJPSFX-HUUCEWRRSA-N |
| XLogP | 1.05 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|