C15H19N5O — CID 131936062
1-(1-ethylpyrazol-3-yl)-N-[(6-methoxy-1H-benzimidazol-2-yl)methyl]methanamine (PubChem CID 131936062) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is 1-(1-ethylpyrazol-3-yl)-N-[(6-methoxy-1H-benzimidazol-2-yl)methyl]methanamine.
| Compound Name | 1-(1-ethylpyrazol-3-yl)-N-[(6-methoxy-1H-benzimidazol-2-yl)methyl]methanamine |
|---|---|
| PubChem CID | 131936062 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 1-(1-ethylpyrazol-3-yl)-N-[(6-methoxy-1H-benzimidazol-2-yl)methyl]methanamine |
| SMILES | CCn1ccc(CNCc2nc3ccc(OC)cc3[nH]2)n1 |
| InChI | InChI=1S/C15H19N5O/c1-3-20-7-6-11(19-20)9-16-10-15-17-13-5-4-12(21-2)8-14(13)18-15/h4-8,16H,3,9-10H2,1-2H3,(H,17,18) |
| InChIKey | UAJPQLDKWCFUTR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |