C16H23N5O4S2 — CID 131936329
4-(dimethylsulfamoylamino)-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]benzenesulfonamide (PubChem CID 131936329) has the molecular formula C16H23N5O4S2 and a molecular weight of 413.53 g/mol. Its IUPAC name is 4-(dimethylsulfamoylamino)-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-(dimethylsulfamoylamino)-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 131936329 |
| Molecular Formula | C16H23N5O4S2 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 4-(dimethylsulfamoylamino)-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]benzenesulfonamide |
| SMILES | Cc1cnccc1NCCNS(=O)(=O)c1ccc(NS(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C16H23N5O4S2/c1-13-12-17-9-8-16(13)18-10-11-19-26(22,23)15-6-4-14(5-7-15)20-27(24,25)21(2)3/h4-9,12,19-20H,10-11H2,1-3H3,(H,17,18) |
| InChIKey | MWUSEVDBPGHULK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|