C13H24N4O2S — CID 131945504
N-[2-[2-[(3-methyl-4-pyridinyl)amino]ethylamino]propyl]ethanesulfonamide (PubChem CID 131945504) has the molecular formula C13H24N4O2S and a molecular weight of 300.43 g/mol. Its IUPAC name is N-[2-[2-[(3-methyl-4-pyridinyl)amino]ethylamino]propyl]ethanesulfonamide.
| Compound Name | N-[2-[2-[(3-methyl-4-pyridinyl)amino]ethylamino]propyl]ethanesulfonamide |
|---|---|
| PubChem CID | 131945504 |
| Molecular Formula | C13H24N4O2S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-[2-[2-[(3-methyl-4-pyridinyl)amino]ethylamino]propyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCC(C)NCCNc1ccncc1C |
| InChI | InChI=1S/C13H24N4O2S/c1-4-20(18,19)17-10-12(3)15-7-8-16-13-5-6-14-9-11(13)2/h5-6,9,12,15,17H,4,7-8,10H2,1-3H3,(H,14,16) |
| InChIKey | PHIJJYNMLCKZAZ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|