C16H18N4O4S — CID 131942865
3-methyl-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]-2-oxo-1,3-benzoxazole-6-sulfonamide (PubChem CID 131942865) has the molecular formula C16H18N4O4S and a molecular weight of 362.41 g/mol. Its IUPAC name is 3-methyl-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]-2-oxo-1,3-benzoxazole-6-sulfonamide.
| Compound Name | 3-methyl-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]-2-oxo-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 131942865 |
| Molecular Formula | C16H18N4O4S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 3-methyl-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]-2-oxo-1,3-benzoxazole-6-sulfonamide |
| SMILES | Cc1cnccc1NCCNS(=O)(=O)c1ccc2c(c1)oc(=O)n2C |
| InChI | InChI=1S/C16H18N4O4S/c1-11-10-17-6-5-13(11)18-7-8-19-25(22,23)12-3-4-14-15(9-12)24-16(21)20(14)2/h3-6,9-10,19H,7-8H2,1-2H3,(H,17,18) |
| InChIKey | QQIAYDPEPWHYIW-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 106.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|