C18H25N5O3S — CID 131938246
2-[4-[[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethylamino]methyl]phenoxy]-1-morpholin-4-ylethanone (PubChem CID 131938246) has the molecular formula C18H25N5O3S and a molecular weight of 391.50 g/mol. Its IUPAC name is 2-[4-[[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethylamino]methyl]phenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[4-[[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethylamino]methyl]phenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 131938246 |
| Molecular Formula | C18H25N5O3S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 2-[4-[[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethylamino]methyl]phenoxy]-1-morpholin-4-ylethanone |
| SMILES | Cc1nc(SCCNCc2ccc(OCC(=O)N3CCOCC3)cc2)n[nH]1 |
| InChI | InChI=1S/C18H25N5O3S/c1-14-20-18(22-21-14)27-11-6-19-12-15-2-4-16(5-3-15)26-13-17(24)23-7-9-25-10-8-23/h2-5,19H,6-13H2,1H3,(H,20,21,22) |
| InChIKey | OMVCWVUUTQNFDX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|