C22H22FN3O3 — CID 131938558
N-[[1-(6-fluoro-2-methylquinoline-4-carbonyl)piperidin-4-yl]methyl]furan-3-carboxamide (PubChem CID 131938558) has the molecular formula C22H22FN3O3 and a molecular weight of 395.43 g/mol. Its IUPAC name is N-[[1-(6-fluoro-2-methylquinoline-4-carbonyl)piperidin-4-yl]methyl]furan-3-carboxamide.
| Compound Name | N-[[1-(6-fluoro-2-methylquinoline-4-carbonyl)piperidin-4-yl]methyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 131938558 |
| Molecular Formula | C22H22FN3O3 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N-[[1-(6-fluoro-2-methylquinoline-4-carbonyl)piperidin-4-yl]methyl]furan-3-carboxamide |
| SMILES | Cc1cc(C(=O)N2CCC(CNC(=O)c3ccoc3)CC2)c2cc(F)ccc2n1 |
| InChI | InChI=1S/C22H22FN3O3/c1-14-10-19(18-11-17(23)2-3-20(18)25-14)22(28)26-7-4-15(5-8-26)12-24-21(27)16-6-9-29-13-16/h2-3,6,9-11,13,15H,4-5,7-8,12H2,1H3,(H,24,27) |
| InChIKey | YUBGFZHSBLLZTH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |