C21H26N4O2S — CID 131938755
4-methyl-N-[3-[[1-(2-methylphenyl)pyrazol-4-yl]methylamino]propyl]benzenesulfonamide (PubChem CID 131938755) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is 4-methyl-N-[3-[[1-(2-methylphenyl)pyrazol-4-yl]methylamino]propyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[3-[[1-(2-methylphenyl)pyrazol-4-yl]methylamino]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 131938755 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 4-methyl-N-[3-[[1-(2-methylphenyl)pyrazol-4-yl]methylamino]propyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCNCc2cnn(-c3ccccc3C)c2)cc1 |
| InChI | InChI=1S/C21H26N4O2S/c1-17-8-10-20(11-9-17)28(26,27)24-13-5-12-22-14-19-15-23-25(16-19)21-7-4-3-6-18(21)2/h3-4,6-11,15-16,22,24H,5,12-14H2,1-2H3 |
| InChIKey | LLAPMXXPWLAEQR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|