C15H22ClN3OS — CID 131940761
1-[3-[(4-chlorophenyl)methylsulfanyl]propyl]-3-[(3R)-pyrrolidin-3-yl]urea (PubChem CID 131940761) has the molecular formula C15H22ClN3OS and a molecular weight of 327.88 g/mol. Its IUPAC name is 1-[3-[(4-chlorophenyl)methylsulfanyl]propyl]-3-[(3R)-pyrrolidin-3-yl]urea.
| Compound Name | 1-[3-[(4-chlorophenyl)methylsulfanyl]propyl]-3-[(3R)-pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 131940761 |
| Molecular Formula | C15H22ClN3OS |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 1-[3-[(4-chlorophenyl)methylsulfanyl]propyl]-3-[(3R)-pyrrolidin-3-yl]urea |
| SMILES | O=C(NCCCSCc1ccc(Cl)cc1)N[C@@H]1CCNC1 |
| InChI | InChI=1S/C15H22ClN3OS/c16-13-4-2-12(3-5-13)11-21-9-1-7-18-15(20)19-14-6-8-17-10-14/h2-5,14,17H,1,6-11H2,(H2,18,19,20)/t14-/m1/s1 |
| InChIKey | YOMZXOORKPOLSM-CQSZACIVSA-N |
| XLogP | 2.62 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|