C27H33N3O4 — CID 131943642
3-(1-methylpiperidine-4-carbonyl)-11,18-dioxa-3,14-diazatetracyclo[17.3.1.16,10.02,7]tetracosa-1(23),6,8,10(24),19,21-hexaen-13-one (PubChem CID 131943642) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is 3-(1-methylpiperidine-4-carbonyl)-11,18-dioxa-3,14-diazatetracyclo[17.3.1.16,10.02,7]tetracosa-1(23),6,8,10(24),19,21-hexaen-13-one.
| Compound Name | 3-(1-methylpiperidine-4-carbonyl)-11,18-dioxa-3,14-diazatetracyclo[17.3.1.16,10.02,7]tetracosa-1(23),6,8,10(24),19,21-hexaen-13-one |
|---|---|
| PubChem CID | 131943642 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | 3-(1-methylpiperidine-4-carbonyl)-11,18-dioxa-3,14-diazatetracyclo[17.3.1.16,10.02,7]tetracosa-1(23),6,8,10(24),19,21-hexaen-13-one |
| SMILES | CN1CCC(C(=O)N2CCc3cc4ccc3C2c2cccc(c2)OCCCNC(=O)CO4)CC1 |
| InChI | InChI=1S/C27H33N3O4/c1-29-12-8-19(9-13-29)27(32)30-14-10-20-16-23-6-7-24(20)26(30)21-4-2-5-22(17-21)33-15-3-11-28-25(31)18-34-23/h2,4-7,16-17,19,26H,3,8-15,18H2,1H3,(H,28,31) |
| InChIKey | AJZMXKQMGPXYPH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |