C23H27NO3 — CID 131945412
N-[(3-ethoxyphenyl)methyl]-N-ethyl-4-(3-hydroxy-3-methylbut-1-ynyl)benzamide (PubChem CID 131945412) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is N-[(3-ethoxyphenyl)methyl]-N-ethyl-4-(3-hydroxy-3-methylbut-1-ynyl)benzamide.
| Compound Name | N-[(3-ethoxyphenyl)methyl]-N-ethyl-4-(3-hydroxy-3-methylbut-1-ynyl)benzamide |
|---|---|
| PubChem CID | 131945412 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | N-[(3-ethoxyphenyl)methyl]-N-ethyl-4-(3-hydroxy-3-methylbut-1-ynyl)benzamide |
| SMILES | CCOc1cccc(CN(CC)C(=O)c2ccc(C#CC(C)(C)O)cc2)c1 |
| InChI | InChI=1S/C23H27NO3/c1-5-24(17-19-8-7-9-21(16-19)27-6-2)22(25)20-12-10-18(11-13-20)14-15-23(3,4)26/h7-13,16,26H,5-6,17H2,1-4H3 |
| InChIKey | DTNMBSQIPAWSRM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|