C15H24N4 — CID 131947795
1-(cyclohexen-1-ylmethyl)-3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine (PubChem CID 131947795) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is 1-(cyclohexen-1-ylmethyl)-3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine.
| Compound Name | 1-(cyclohexen-1-ylmethyl)-3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine |
|---|---|
| PubChem CID | 131947795 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 1-(cyclohexen-1-ylmethyl)-3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine |
| SMILES | Cc1nc(C2CCCN(CC3=CCCCC3)C2)n[nH]1 |
| InChI | InChI=1S/C15H24N4/c1-12-16-15(18-17-12)14-8-5-9-19(11-14)10-13-6-3-2-4-7-13/h6,14H,2-5,7-11H2,1H3,(H,16,17,18) |
| InChIKey | MMYSWWHKCOLTDD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|