C12H20N4 — CID 103991471
N-(cyclohex-3-en-1-ylmethyl)-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanamine (PubChem CID 103991471) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is N-(cyclohex-3-en-1-ylmethyl)-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanamine.
| Compound Name | N-(cyclohex-3-en-1-ylmethyl)-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 103991471 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | N-(cyclohex-3-en-1-ylmethyl)-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanamine |
| SMILES | Cc1nc(CCNCC2CC=CCC2)n[nH]1 |
| InChI | InChI=1S/C12H20N4/c1-10-14-12(16-15-10)7-8-13-9-11-5-3-2-4-6-11/h2-3,11,13H,4-9H2,1H3,(H,14,15,16) |
| InChIKey | MAXQCUPOFXRCHV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|