C11H17N5 — CID 147748989
(Z)-N-methyl-1-(5-pyrrolidin-3-yl-1H-1,2,4-triazol-3-yl)but-2-en-1-imine (PubChem CID 147748989) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is (Z)-N-methyl-1-(5-pyrrolidin-3-yl-1H-1,2,4-triazol-3-yl)but-2-en-1-imine.
| Compound Name | (Z)-N-methyl-1-(5-pyrrolidin-3-yl-1H-1,2,4-triazol-3-yl)but-2-en-1-imine |
|---|---|
| PubChem CID | 147748989 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | (Z)-N-methyl-1-(5-pyrrolidin-3-yl-1H-1,2,4-triazol-3-yl)but-2-en-1-imine |
| SMILES | C/C=C\C(=N/C)c1n[nH]c(C2CCNC2)n1 |
| InChI | InChI=1S/C11H17N5/c1-3-4-9(12-2)11-14-10(15-16-11)8-5-6-13-7-8/h3-4,8,13H,5-7H2,1-2H3,(H,14,15,16)/b4-3-,12-9+ |
| InChIKey | HBVDZWZFTWIAMY-CVTZKADISA-N |
| XLogP | 0.88 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|