C13H10ClNO2 — CID 13194948
2-(4-chlorophenyl)-5,6-dihydro-4H-cyclopenta[c]pyrrole-1,3-dione (PubChem CID 13194948) has the molecular formula C13H10ClNO2 and a molecular weight of 247.68 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5,6-dihydro-4H-cyclopenta[c]pyrrole-1,3-dione.
| Compound Name | 2-(4-chlorophenyl)-5,6-dihydro-4H-cyclopenta[c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 13194948 |
| Molecular Formula | C13H10ClNO2 |
| Molecular Weight | 247.68 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 2-(4-chlorophenyl)-5,6-dihydro-4H-cyclopenta[c]pyrrole-1,3-dione |
| SMILES | O=C1C2=C(CCC2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H10ClNO2/c14-8-4-6-9(7-5-8)15-12(16)10-2-1-3-11(10)13(15)17/h4-7H,1-3H2 |
| InChIKey | CBDIPPOVMBURHG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.68 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|