C14H8ClNO4 — CID 57046959
2-(4-chlorophenyl)-6,7-dihydroisoindole-1,3,4,5-tetrone (PubChem CID 57046959) has the molecular formula C14H8ClNO4 and a molecular weight of 289.67 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6,7-dihydroisoindole-1,3,4,5-tetrone.
| Compound Name | 2-(4-chlorophenyl)-6,7-dihydroisoindole-1,3,4,5-tetrone |
|---|---|
| PubChem CID | 57046959 |
| Molecular Formula | C14H8ClNO4 |
| Molecular Weight | 289.67 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 2-(4-chlorophenyl)-6,7-dihydroisoindole-1,3,4,5-tetrone |
| SMILES | O=C1CCC2=C(C1=O)C(=O)N(c1ccc(Cl)cc1)C2=O |
| InChI | InChI=1S/C14H8ClNO4/c15-7-1-3-8(4-2-7)16-13(19)9-5-6-10(17)12(18)11(9)14(16)20/h1-4H,5-6H2 |
| InChIKey | ADUNEDLKHZQKTB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.67 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|