C14H15N5O2 — CID 131949635
6-[[(7R,8aS)-2-methyl-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-7-yl]amino]pyridine-3-carbonitrile (PubChem CID 131949635) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 6-[[(7R,8aS)-2-methyl-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-7-yl]amino]pyridine-3-carbonitrile.
| Compound Name | 6-[[(7R,8aS)-2-methyl-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-7-yl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 131949635 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 6-[[(7R,8aS)-2-methyl-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-7-yl]amino]pyridine-3-carbonitrile |
| SMILES | CN1CC(=O)N2C[C@H](Nc3ccc(C#N)cn3)C[C@H]2C1=O |
| InChI | InChI=1S/C14H15N5O2/c1-18-8-13(20)19-7-10(4-11(19)14(18)21)17-12-3-2-9(5-15)6-16-12/h2-3,6,10-11H,4,7-8H2,1H3,(H,16,17)/t10-,11+/m1/s1 |
| InChIKey | INHWUBJQZRIRHP-MNOVXSKESA-N |
| XLogP | -0.19 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |