C22H19FN4O4S — CID 131953880
N-(1,3-benzothiazol-2-yl)-6-fluoro-1-[5-(hydroxyamino)-5-oxopentyl]-4-oxoquinoline-3-carboxamide (PubChem CID 131953880) has the molecular formula C22H19FN4O4S and a molecular weight of 454.48 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-6-fluoro-1-[5-(hydroxyamino)-5-oxopentyl]-4-oxoquinoline-3-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-6-fluoro-1-[5-(hydroxyamino)-5-oxopentyl]-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 131953880 |
| Molecular Formula | C22H19FN4O4S |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-6-fluoro-1-[5-(hydroxyamino)-5-oxopentyl]-4-oxoquinoline-3-carboxamide |
| SMILES | O=C(CCCCn1cc(C(=O)Nc2nc3ccccc3s2)c(=O)c2cc(F)ccc21)NO |
| InChI | InChI=1S/C22H19FN4O4S/c23-13-8-9-17-14(11-13)20(29)15(12-27(17)10-4-3-7-19(28)26-31)21(30)25-22-24-16-5-1-2-6-18(16)32-22/h1-2,5-6,8-9,11-12,31H,3-4,7,10H2,(H,26,28)(H,24,25,30) |
| InChIKey | KDMIKHDCUCAGHH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|