C10H12N2 — CID 13196080
3-(4-methylphenyl)-4,5-dihydro-1H-pyrazole (PubChem CID 13196080) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 3-(4-methylphenyl)-4,5-dihydro-1H-pyrazole.
| Compound Name | 3-(4-methylphenyl)-4,5-dihydro-1H-pyrazole |
|---|---|
| PubChem CID | 13196080 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 3-(4-methylphenyl)-4,5-dihydro-1H-pyrazole |
| SMILES | Cc1ccc(C2=NNCC2)cc1 |
| InChI | InChI=1S/C10H12N2/c1-8-2-4-9(5-3-8)10-6-7-11-12-10/h2-5,11H,6-7H2,1H3 |
| InChIKey | AMMQKVNYLNSIQT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |