C13H20FN5O — CID 131962048
4-[3-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propyl]piperazin-2-one (PubChem CID 131962048) has the molecular formula C13H20FN5O and a molecular weight of 281.33 g/mol. Its IUPAC name is 4-[3-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propyl]piperazin-2-one.
| Compound Name | 4-[3-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propyl]piperazin-2-one |
|---|---|
| PubChem CID | 131962048 |
| Molecular Formula | C13H20FN5O |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 4-[3-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propyl]piperazin-2-one |
| SMILES | Cc1nc(C)c(F)c(NCCCN2CCNC(=O)C2)n1 |
| InChI | InChI=1S/C13H20FN5O/c1-9-12(14)13(18-10(2)17-9)16-4-3-6-19-7-5-15-11(20)8-19/h3-8H2,1-2H3,(H,15,20)(H,16,17,18) |
| InChIKey | JGWYYUXSLNTQKC-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|