C19H36N4O — CID 131966260
2-hexyl-2-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]octanamide (PubChem CID 131966260) has the molecular formula C19H36N4O and a molecular weight of 336.52 g/mol. Its IUPAC name is 2-hexyl-2-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]octanamide.
| Compound Name | 2-hexyl-2-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]octanamide |
|---|---|
| PubChem CID | 131966260 |
| Molecular Formula | C19H36N4O |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.29 |
| IUPAC Name | 2-hexyl-2-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]octanamide |
| SMILES | CCCCCCC(C)(CCCCCC)C(=O)NCc1n[nH]c(C)n1 |
| InChI | InChI=1S/C19H36N4O/c1-5-7-9-11-13-19(4,14-12-10-8-6-2)18(24)20-15-17-21-16(3)22-23-17/h5-15H2,1-4H3,(H,20,24)(H,21,22,23) |
| InChIKey | ZQUUUYSCOLQFGN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|