C21H22F8N4O — CID 131966409
[4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-[6-(2,2,2-trifluoroethyl)-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-3-yl]methanol (PubChem CID 131966409) has the molecular formula C21H22F8N4O and a molecular weight of 498.42 g/mol. Its IUPAC name is [4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-[6-(2,2,2-trifluoroethyl)-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-3-yl]methanol.
| Compound Name | [4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-[6-(2,2,2-trifluoroethyl)-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-3-yl]methanol |
|---|---|
| PubChem CID | 131966409 |
| Molecular Formula | C21H22F8N4O |
| Molecular Weight | 498.42 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | [4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-[6-(2,2,2-trifluoroethyl)-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-3-yl]methanol |
| SMILES | OC(c1n[nH]c2c1CCN(CC(F)(F)F)C2)N1CCC(c2ccc(F)c(F)c2C(F)(F)F)CC1 |
| InChI | InChI=1S/C21H22F8N4O/c22-14-2-1-12(16(17(14)23)21(27,28)29)11-3-7-33(8-4-11)19(34)18-13-5-6-32(10-20(24,25)26)9-15(13)30-31-18/h1-2,11,19,34H,3-10H2,(H,30,31) |
| InChIKey | ILVFIKGXIPPGNU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 55.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |