C22H25F5N4O2 — CID 123790468
1-[3-[[4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-hydroxymethyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]propan-1-one (PubChem CID 123790468) has the molecular formula C22H25F5N4O2 and a molecular weight of 472.46 g/mol. Its IUPAC name is 1-[3-[[4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-hydroxymethyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]propan-1-one.
| Compound Name | 1-[3-[[4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-hydroxymethyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]propan-1-one |
|---|---|
| PubChem CID | 123790468 |
| Molecular Formula | C22H25F5N4O2 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 1-[3-[[4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-hydroxymethyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]propan-1-one |
| SMILES | CCC(=O)N1CCc2c(C(O)N3CCC(c4ccc(F)c(F)c4C(F)(F)F)CC3)n[nH]c2C1 |
| InChI | InChI=1S/C22H25F5N4O2/c1-2-17(32)31-10-7-14-16(11-31)28-29-20(14)21(33)30-8-5-12(6-9-30)13-3-4-15(23)19(24)18(13)22(25,26)27/h3-4,12,21,33H,2,5-11H2,1H3,(H,28,29) |
| InChIKey | KJUIEIYKTPXSPS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |