C24H27F5N4O2 — CID 118483530
4-[3-[4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine-1-carbonyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]-3-methylbutanal (PubChem CID 118483530) has the molecular formula C24H27F5N4O2 and a molecular weight of 498.50 g/mol. Its IUPAC name is 4-[3-[4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine-1-carbonyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]-3-methylbutanal.
| Compound Name | 4-[3-[4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine-1-carbonyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]-3-methylbutanal |
|---|---|
| PubChem CID | 118483530 |
| Molecular Formula | C24H27F5N4O2 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | 4-[3-[4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine-1-carbonyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]-3-methylbutanal |
| SMILES | CC(CC=O)CN1CCc2c(C(=O)N3CCC(c4ccc(F)c(F)c4C(F)(F)F)CC3)n[nH]c2C1 |
| InChI | InChI=1S/C24H27F5N4O2/c1-14(7-11-34)12-32-8-6-17-19(13-32)30-31-22(17)23(35)33-9-4-15(5-10-33)16-2-3-18(25)21(26)20(16)24(27,28)29/h2-3,11,14-15H,4-10,12-13H2,1H3,(H,30,31) |
| InChIKey | YXBMHMJEZOVNCV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|