C19H22F3NO6S — CID 131966849
[(7R,8S,12R,13S)-7-[ethyl(methyl)amino]-8-hydroxy-13-methyl-11-oxo-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14)-trien-2-yl] trifluoromethanesulfonate (PubChem CID 131966849) has the molecular formula C19H22F3NO6S and a molecular weight of 449.45 g/mol. Its IUPAC name is [(7R,8S,12R,13S)-7-[ethyl(methyl)amino]-8-hydroxy-13-methyl-11-oxo-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14)-trien-2-yl] trifluoromethanesulfonate.
| Compound Name | [(7R,8S,12R,13S)-7-[ethyl(methyl)amino]-8-hydroxy-13-methyl-11-oxo-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14)-trien-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 131966849 |
| Molecular Formula | C19H22F3NO6S |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | [(7R,8S,12R,13S)-7-[ethyl(methyl)amino]-8-hydroxy-13-methyl-11-oxo-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14)-trien-2-yl] trifluoromethanesulfonate |
| SMILES | CCN(C)[C@@H]1Cc2ccc(OS(=O)(=O)C(F)(F)F)c3c2[C@@]2(C)[C@@H](O3)C(=O)CC[C@@]12O |
| InChI | InChI=1S/C19H22F3NO6S/c1-4-23(3)13-9-10-5-6-12(29-30(26,27)19(20,21)22)15-14(10)17(2)16(28-15)11(24)7-8-18(13,17)25/h5-6,13,16,25H,4,7-9H2,1-3H3/t13-,16+,17+,18-/m1/s1 |
| InChIKey | XPHXISYEWYILPW-XFKAJCMBSA-N |
| XLogP | 1.90 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|