C21H22ClN5O — CID 131967027
5-[(3-chlorophenyl)methyl]-N-(cyclopropylmethyl)-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraene-4-carboxamide (PubChem CID 131967027) has the molecular formula C21H22ClN5O and a molecular weight of 395.89 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)methyl]-N-(cyclopropylmethyl)-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraene-4-carboxamide.
| Compound Name | 5-[(3-chlorophenyl)methyl]-N-(cyclopropylmethyl)-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 131967027 |
| Molecular Formula | C21H22ClN5O |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 5-[(3-chlorophenyl)methyl]-N-(cyclopropylmethyl)-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraene-4-carboxamide |
| SMILES | Cc1nnc2n1C1C=C(C(=O)NCC3CC3)N(Cc3cccc(Cl)c3)C1C=C2 |
| InChI | InChI=1S/C21H22ClN5O/c1-13-24-25-20-8-7-17-18(27(13)20)10-19(21(28)23-11-14-5-6-14)26(17)12-15-3-2-4-16(22)9-15/h2-4,7-10,14,17-18H,5-6,11-12H2,1H3,(H,23,28) |
| InChIKey | SKWZJEFISQYTJI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |