C22H28N6 — CID 166710332
4,12-dimethyl-5-[[3-(piperazin-1-ylmethyl)phenyl]methyl]-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraene (PubChem CID 166710332) has the molecular formula C22H28N6 and a molecular weight of 376.51 g/mol. Its IUPAC name is 4,12-dimethyl-5-[[3-(piperazin-1-ylmethyl)phenyl]methyl]-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraene.
| Compound Name | 4,12-dimethyl-5-[[3-(piperazin-1-ylmethyl)phenyl]methyl]-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraene |
|---|---|
| PubChem CID | 166710332 |
| Molecular Formula | C22H28N6 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 4,12-dimethyl-5-[[3-(piperazin-1-ylmethyl)phenyl]methyl]-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraene |
| SMILES | CC1=CC2C(C=Cc3nnc(C)n32)N1Cc1cccc(CN2CCNCC2)c1 |
| InChI | InChI=1S/C22H28N6/c1-16-12-21-20(6-7-22-25-24-17(2)28(21)22)27(16)15-19-5-3-4-18(13-19)14-26-10-8-23-9-11-26/h3-7,12-13,20-21,23H,8-11,14-15H2,1-2H3 |
| InChIKey | WSCNYKNGVBOVHT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |