C20H20F3N5O — CID 166710354
N-ethyl-12-methyl-5-[[3-(trifluoromethyl)phenyl]methyl]-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraene-4-carboxamide (PubChem CID 166710354) has the molecular formula C20H20F3N5O and a molecular weight of 403.41 g/mol. Its IUPAC name is N-ethyl-12-methyl-5-[[3-(trifluoromethyl)phenyl]methyl]-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraene-4-carboxamide.
| Compound Name | N-ethyl-12-methyl-5-[[3-(trifluoromethyl)phenyl]methyl]-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 166710354 |
| Molecular Formula | C20H20F3N5O |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | N-ethyl-12-methyl-5-[[3-(trifluoromethyl)phenyl]methyl]-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraene-4-carboxamide |
| SMILES | CCNC(=O)C1=CC2C(C=Cc3nnc(C)n32)N1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H20F3N5O/c1-3-24-19(29)17-10-16-15(7-8-18-26-25-12(2)28(16)18)27(17)11-13-5-4-6-14(9-13)20(21,22)23/h4-10,15-16H,3,11H2,1-2H3,(H,24,29) |
| InChIKey | AVDDONBIJFUGNK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |