C29H57NO2 — CID 131967759
6-[(11Z,14Z)-2-methoxyicosa-11,14-dienoxy]-N,5-dimethylhexan-1-amine (PubChem CID 131967759) has the molecular formula C29H57NO2 and a molecular weight of 451.78 g/mol. Its IUPAC name is 6-[(11Z,14Z)-2-methoxyicosa-11,14-dienoxy]-N,5-dimethylhexan-1-amine.
| Compound Name | 6-[(11Z,14Z)-2-methoxyicosa-11,14-dienoxy]-N,5-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 131967759 |
| Molecular Formula | C29H57NO2 |
| Molecular Weight | 451.78 g/mol |
| Exact Mass | 451.44 |
| IUPAC Name | 6-[(11Z,14Z)-2-methoxyicosa-11,14-dienoxy]-N,5-dimethylhexan-1-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(COCC(C)CCCCNC)OC |
| InChI | InChI=1S/C29H57NO2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-29(31-4)27-32-26-28(2)23-21-22-25-30-3/h9-10,12-13,28-30H,5-8,11,14-27H2,1-4H3/b10-9-,13-12- |
| InChIKey | KMYYKDDYSHNHRI-UTJQPWESSA-N |
| XLogP | 8.25 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.78 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|