C18H14Cl2N2O4S3 — CID 131968440
5-[4,5-dichloro-2-(thiophen-2-ylsulfinylamino)anilino]sulfanyl-2-methoxybenzoic acid (PubChem CID 131968440) has the molecular formula C18H14Cl2N2O4S3 and a molecular weight of 489.43 g/mol. Its IUPAC name is 5-[4,5-dichloro-2-(thiophen-2-ylsulfinylamino)anilino]sulfanyl-2-methoxybenzoic acid.
| Compound Name | 5-[4,5-dichloro-2-(thiophen-2-ylsulfinylamino)anilino]sulfanyl-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 131968440 |
| Molecular Formula | C18H14Cl2N2O4S3 |
| Molecular Weight | 489.43 g/mol |
| Exact Mass | 487.95 |
| IUPAC Name | 5-[4,5-dichloro-2-(thiophen-2-ylsulfinylamino)anilino]sulfanyl-2-methoxybenzoic acid |
| SMILES | COc1ccc(SNc2cc(Cl)c(Cl)cc2NS(=O)c2cccs2)cc1C(=O)O |
| InChI | InChI=1S/C18H14Cl2N2O4S3/c1-26-16-5-4-10(7-11(16)18(23)24)28-21-14-8-12(19)13(20)9-15(14)22-29(25)17-3-2-6-27-17/h2-9,21-22H,1H3,(H,23,24) |
| InChIKey | YPRMHNLAEVGWCW-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.43 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|