C26H34N4O4S2 — CID 131971658
N-cyclopropylsulfonyl-4-(5-cyclopropylthiophen-2-yl)-2-(1-hexylpyrazol-4-yl)-2-methyl-6-oxo-1,3-dihydropyridine-5-carboxamide (PubChem CID 131971658) has the molecular formula C26H34N4O4S2 and a molecular weight of 530.72 g/mol. Its IUPAC name is N-cyclopropylsulfonyl-4-(5-cyclopropylthiophen-2-yl)-2-(1-hexylpyrazol-4-yl)-2-methyl-6-oxo-1,3-dihydropyridine-5-carboxamide.
| Compound Name | N-cyclopropylsulfonyl-4-(5-cyclopropylthiophen-2-yl)-2-(1-hexylpyrazol-4-yl)-2-methyl-6-oxo-1,3-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 131971658 |
| Molecular Formula | C26H34N4O4S2 |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | N-cyclopropylsulfonyl-4-(5-cyclopropylthiophen-2-yl)-2-(1-hexylpyrazol-4-yl)-2-methyl-6-oxo-1,3-dihydropyridine-5-carboxamide |
| SMILES | CCCCCCn1cc(C2(C)CC(c3ccc(C4CC4)s3)=C(C(=O)NS(=O)(=O)C3CC3)C(=O)N2)cn1 |
| InChI | InChI=1S/C26H34N4O4S2/c1-3-4-5-6-13-30-16-18(15-27-30)26(2)14-20(22-12-11-21(35-22)17-7-8-17)23(24(31)28-26)25(32)29-36(33,34)19-9-10-19/h11-12,15-17,19H,3-10,13-14H2,1-2H3,(H,28,31)(H,29,32) |
| InChIKey | RFRGWBOMCILIKF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|