C27H34N4O4S — CID 131971649
4-(1-cyclopropylpyrazol-3-yl)-N-cyclopropylsulfonyl-2-methyl-6-oxo-2-(4-pentylphenyl)-1,3-dihydropyridine-5-carboxamide (PubChem CID 131971649) has the molecular formula C27H34N4O4S and a molecular weight of 510.66 g/mol. Its IUPAC name is 4-(1-cyclopropylpyrazol-3-yl)-N-cyclopropylsulfonyl-2-methyl-6-oxo-2-(4-pentylphenyl)-1,3-dihydropyridine-5-carboxamide.
| Compound Name | 4-(1-cyclopropylpyrazol-3-yl)-N-cyclopropylsulfonyl-2-methyl-6-oxo-2-(4-pentylphenyl)-1,3-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 131971649 |
| Molecular Formula | C27H34N4O4S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | 4-(1-cyclopropylpyrazol-3-yl)-N-cyclopropylsulfonyl-2-methyl-6-oxo-2-(4-pentylphenyl)-1,3-dihydropyridine-5-carboxamide |
| SMILES | CCCCCc1ccc(C2(C)CC(c3ccn(C4CC4)n3)=C(C(=O)NS(=O)(=O)C3CC3)C(=O)N2)cc1 |
| InChI | InChI=1S/C27H34N4O4S/c1-3-4-5-6-18-7-9-19(10-8-18)27(2)17-22(23-15-16-31(29-23)20-11-12-20)24(25(32)28-27)26(33)30-36(34,35)21-13-14-21/h7-10,15-16,20-21H,3-6,11-14,17H2,1-2H3,(H,28,32)(H,30,33) |
| InChIKey | WVDCQFOHYOMPAE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|