C24H28N6O2 — CID 130444459
2-(4-butoxyphenyl)-4-(1-cyclopropylpyrazol-3-yl)-2-methyl-5-(1H-1,2,4-triazol-5-yl)-1,3-dihydropyridin-6-one (PubChem CID 130444459) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-4-(1-cyclopropylpyrazol-3-yl)-2-methyl-5-(1H-1,2,4-triazol-5-yl)-1,3-dihydropyridin-6-one.
| Compound Name | 2-(4-butoxyphenyl)-4-(1-cyclopropylpyrazol-3-yl)-2-methyl-5-(1H-1,2,4-triazol-5-yl)-1,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 130444459 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 2-(4-butoxyphenyl)-4-(1-cyclopropylpyrazol-3-yl)-2-methyl-5-(1H-1,2,4-triazol-5-yl)-1,3-dihydropyridin-6-one |
| SMILES | CCCCOc1ccc(C2(C)CC(c3ccn(C4CC4)n3)=C(c3ncn[nH]3)C(=O)N2)cc1 |
| InChI | InChI=1S/C24H28N6O2/c1-3-4-13-32-18-9-5-16(6-10-18)24(2)14-19(20-11-12-30(29-20)17-7-8-17)21(23(31)27-24)22-25-15-26-28-22/h5-6,9-12,15,17H,3-4,7-8,13-14H2,1-2H3,(H,27,31)(H,25,26,28) |
| InChIKey | IQYPSNXBOJGTME-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|