C24H31NO2S — CID 130206344
(2S)-2-(4-hexoxyphenyl)-2,5-dimethyl-4-(5-methylthiophen-2-yl)-1,3-dihydropyridin-6-one (PubChem CID 130206344) has the molecular formula C24H31NO2S and a molecular weight of 397.58 g/mol. Its IUPAC name is (2S)-2-(4-hexoxyphenyl)-2,5-dimethyl-4-(5-methylthiophen-2-yl)-1,3-dihydropyridin-6-one.
| Compound Name | (2S)-2-(4-hexoxyphenyl)-2,5-dimethyl-4-(5-methylthiophen-2-yl)-1,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 130206344 |
| Molecular Formula | C24H31NO2S |
| Molecular Weight | 397.58 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | (2S)-2-(4-hexoxyphenyl)-2,5-dimethyl-4-(5-methylthiophen-2-yl)-1,3-dihydropyridin-6-one |
| SMILES | CCCCCCOc1ccc([C@]2(C)CC(c3ccc(C)s3)=C(C)C(=O)N2)cc1 |
| InChI | InChI=1S/C24H31NO2S/c1-5-6-7-8-15-27-20-12-10-19(11-13-20)24(4)16-21(18(3)23(26)25-24)22-14-9-17(2)28-22/h9-14H,5-8,15-16H2,1-4H3,(H,25,26)/t24-/m0/s1 |
| InChIKey | XUUVFVQXFPYNLA-DEOSSOPVSA-N |
| XLogP | 6.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.58 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|