C24H25FN4O4S — CID 134489862
(2S)-4-(5-acetylthiophen-2-yl)-2-(4-butoxy-2-fluorophenyl)-2-methyl-5-(5-oxo-4H-triazol-1-yl)-1,3-dihydropyridin-6-one (PubChem CID 134489862) has the molecular formula C24H25FN4O4S and a molecular weight of 484.55 g/mol. Its IUPAC name is (2S)-4-(5-acetylthiophen-2-yl)-2-(4-butoxy-2-fluorophenyl)-2-methyl-5-(5-oxo-4H-triazol-1-yl)-1,3-dihydropyridin-6-one.
| Compound Name | (2S)-4-(5-acetylthiophen-2-yl)-2-(4-butoxy-2-fluorophenyl)-2-methyl-5-(5-oxo-4H-triazol-1-yl)-1,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 134489862 |
| Molecular Formula | C24H25FN4O4S |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | (2S)-4-(5-acetylthiophen-2-yl)-2-(4-butoxy-2-fluorophenyl)-2-methyl-5-(5-oxo-4H-triazol-1-yl)-1,3-dihydropyridin-6-one |
| SMILES | CCCCOc1ccc([C@]2(C)CC(c3ccc(C(C)=O)s3)=C(N3N=NCC3=O)C(=O)N2)c(F)c1 |
| InChI | InChI=1S/C24H25FN4O4S/c1-4-5-10-33-15-6-7-17(18(25)11-15)24(3)12-16(20-9-8-19(34-20)14(2)30)22(23(32)27-24)29-21(31)13-26-28-29/h6-9,11H,4-5,10,12-13H2,1-3H3,(H,27,32)/t24-/m0/s1 |
| InChIKey | SJHRDAOSHGGOQO-DEOSSOPVSA-N |
| XLogP | 4.62 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|