C27H33FN4O5S — CID 131971644
2-(4-butoxy-2-fluorophenyl)-4-[1-(cyclopropylmethyl)pyrazol-3-yl]-N-cyclopropylsulfonyl-2-methyl-6-oxo-1,3-dihydropyridine-5-carboxamide (PubChem CID 131971644) has the molecular formula C27H33FN4O5S and a molecular weight of 544.65 g/mol. Its IUPAC name is 2-(4-butoxy-2-fluorophenyl)-4-[1-(cyclopropylmethyl)pyrazol-3-yl]-N-cyclopropylsulfonyl-2-methyl-6-oxo-1,3-dihydropyridine-5-carboxamide.
| Compound Name | 2-(4-butoxy-2-fluorophenyl)-4-[1-(cyclopropylmethyl)pyrazol-3-yl]-N-cyclopropylsulfonyl-2-methyl-6-oxo-1,3-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 131971644 |
| Molecular Formula | C27H33FN4O5S |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | 2-(4-butoxy-2-fluorophenyl)-4-[1-(cyclopropylmethyl)pyrazol-3-yl]-N-cyclopropylsulfonyl-2-methyl-6-oxo-1,3-dihydropyridine-5-carboxamide |
| SMILES | CCCCOc1ccc(C2(C)CC(c3ccn(CC4CC4)n3)=C(C(=O)NS(=O)(=O)C3CC3)C(=O)N2)c(F)c1 |
| InChI | InChI=1S/C27H33FN4O5S/c1-3-4-13-37-18-7-10-21(22(28)14-18)27(2)15-20(23-11-12-32(30-23)16-17-5-6-17)24(25(33)29-27)26(34)31-38(35,36)19-8-9-19/h7,10-12,14,17,19H,3-6,8-9,13,15-16H2,1-2H3,(H,29,33)(H,31,34) |
| InChIKey | RNNIYWIREZFQSU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|