C28H35N3O6S — CID 131971965
N-cyclopropylsulfonyl-2-(4-hexoxyphenyl)-4-(6-methoxy-3-pyridinyl)-2-methyl-6-oxo-1,3-dihydropyridine-5-carboxamide (PubChem CID 131971965) has the molecular formula C28H35N3O6S and a molecular weight of 541.67 g/mol. Its IUPAC name is N-cyclopropylsulfonyl-2-(4-hexoxyphenyl)-4-(6-methoxy-3-pyridinyl)-2-methyl-6-oxo-1,3-dihydropyridine-5-carboxamide.
| Compound Name | N-cyclopropylsulfonyl-2-(4-hexoxyphenyl)-4-(6-methoxy-3-pyridinyl)-2-methyl-6-oxo-1,3-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 131971965 |
| Molecular Formula | C28H35N3O6S |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | N-cyclopropylsulfonyl-2-(4-hexoxyphenyl)-4-(6-methoxy-3-pyridinyl)-2-methyl-6-oxo-1,3-dihydropyridine-5-carboxamide |
| SMILES | CCCCCCOc1ccc(C2(C)CC(c3ccc(OC)nc3)=C(C(=O)NS(=O)(=O)C3CC3)C(=O)N2)cc1 |
| InChI | InChI=1S/C28H35N3O6S/c1-4-5-6-7-16-37-21-11-9-20(10-12-21)28(2)17-23(19-8-15-24(36-3)29-18-19)25(26(32)30-28)27(33)31-38(34,35)22-13-14-22/h8-12,15,18,22H,4-7,13-14,16-17H2,1-3H3,(H,30,32)(H,31,33) |
| InChIKey | KYBMALAQNASBKI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|