C28H30F6N2O5S — CID 86344002
(2S)-N-ethylsulfonyl-4-(4-methylphenyl)-6-oxo-2-[4-(6,6,6-trifluorohexoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide (PubChem CID 86344002) has the molecular formula C28H30F6N2O5S and a molecular weight of 620.61 g/mol. Its IUPAC name is (2S)-N-ethylsulfonyl-4-(4-methylphenyl)-6-oxo-2-[4-(6,6,6-trifluorohexoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide.
| Compound Name | (2S)-N-ethylsulfonyl-4-(4-methylphenyl)-6-oxo-2-[4-(6,6,6-trifluorohexoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 86344002 |
| Molecular Formula | C28H30F6N2O5S |
| Molecular Weight | 620.61 g/mol |
| Exact Mass | 620.18 |
| IUPAC Name | (2S)-N-ethylsulfonyl-4-(4-methylphenyl)-6-oxo-2-[4-(6,6,6-trifluorohexoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
| SMILES | CCS(=O)(=O)NC(=O)C1=C(c2ccc(C)cc2)C[C@](c2ccc(OCCCCCC(F)(F)F)cc2)(C(F)(F)F)NC1=O |
| InChI | InChI=1S/C28H30F6N2O5S/c1-3-42(39,40)36-25(38)23-22(19-9-7-18(2)8-10-19)17-26(28(32,33)34,35-24(23)37)20-11-13-21(14-12-20)41-16-6-4-5-15-27(29,30)31/h7-14H,3-6,15-17H2,1-2H3,(H,35,37)(H,36,38)/t26-/m0/s1 |
| InChIKey | WEMZSVAXFIISGA-SANMLTNESA-N |
| XLogP | 5.69 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|