C31H28F6N2O3 — CID 122362733
N,4-bis(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide (PubChem CID 122362733) has the molecular formula C31H28F6N2O3 and a molecular weight of 590.56 g/mol. Its IUPAC name is N,4-bis(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide.
| Compound Name | N,4-bis(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 122362733 |
| Molecular Formula | C31H28F6N2O3 |
| Molecular Weight | 590.56 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | N,4-bis(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2=C(c3ccc(C)cc3)CC(c3ccc(OCCCC(F)(F)F)cc3)(C(F)(F)F)NC2=O)cc1 |
| InChI | InChI=1S/C31H28F6N2O3/c1-19-4-8-21(9-5-19)25-18-29(31(35,36)37,22-10-14-24(15-11-22)42-17-3-16-30(32,33)34)39-28(41)26(25)27(40)38-23-12-6-20(2)7-13-23/h4-15H,3,16-18H2,1-2H3,(H,38,40)(H,39,41) |
| InChIKey | HBWGSZZXRWSMSM-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.56 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|