C24H21F6N3O4S — CID 122362840
4-[4-(methylperoxysulfanylamino)phenyl]-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carbonitrile (PubChem CID 122362840) has the molecular formula C24H21F6N3O4S and a molecular weight of 561.50 g/mol. Its IUPAC name is 4-[4-(methylperoxysulfanylamino)phenyl]-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carbonitrile.
| Compound Name | 4-[4-(methylperoxysulfanylamino)phenyl]-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carbonitrile |
|---|---|
| PubChem CID | 122362840 |
| Molecular Formula | C24H21F6N3O4S |
| Molecular Weight | 561.50 g/mol |
| Exact Mass | 561.12 |
| IUPAC Name | 4-[4-(methylperoxysulfanylamino)phenyl]-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carbonitrile |
| SMILES | COOSNc1ccc(C2=C(C#N)C(=O)NC(c3ccc(OCCCC(F)(F)F)cc3)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C24H21F6N3O4S/c1-35-37-38-33-17-7-3-15(4-8-17)19-13-22(24(28,29)30,32-21(34)20(19)14-31)16-5-9-18(10-6-16)36-12-2-11-23(25,26)27/h3-10,33H,2,11-13H2,1H3,(H,32,34) |
| InChIKey | NSZVYGFLRUZXHN-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.50 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|