C26H27F6N3O5S — CID 130421863
N-(dimethylsulfamoyl)-4-(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide (PubChem CID 130421863) has the molecular formula C26H27F6N3O5S and a molecular weight of 607.57 g/mol. Its IUPAC name is N-(dimethylsulfamoyl)-4-(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide.
| Compound Name | N-(dimethylsulfamoyl)-4-(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 130421863 |
| Molecular Formula | C26H27F6N3O5S |
| Molecular Weight | 607.57 g/mol |
| Exact Mass | 607.16 |
| IUPAC Name | N-(dimethylsulfamoyl)-4-(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
| SMILES | Cc1ccc(C2=C(C(=O)NS(=O)(=O)N(C)C)C(=O)NC(c3ccc(OCCCC(F)(F)F)cc3)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C26H27F6N3O5S/c1-16-5-7-17(8-6-16)20-15-24(26(30,31)32,33-22(36)21(20)23(37)34-41(38,39)35(2)3)18-9-11-19(12-10-18)40-14-4-13-25(27,28)29/h5-12H,4,13-15H2,1-3H3,(H,33,36)(H,34,37) |
| InChIKey | LAZKJJYYJYPNGV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.57 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|