C29H29F7N2O5S — CID 130421841
4-(4-cyclopropylphenyl)-2-[2-fluoro-4-(6,6,6-trifluorohexoxy)phenyl]-N-methylsulfonyl-6-oxo-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide (PubChem CID 130421841) has the molecular formula C29H29F7N2O5S and a molecular weight of 650.61 g/mol. Its IUPAC name is 4-(4-cyclopropylphenyl)-2-[2-fluoro-4-(6,6,6-trifluorohexoxy)phenyl]-N-methylsulfonyl-6-oxo-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide.
| Compound Name | 4-(4-cyclopropylphenyl)-2-[2-fluoro-4-(6,6,6-trifluorohexoxy)phenyl]-N-methylsulfonyl-6-oxo-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 130421841 |
| Molecular Formula | C29H29F7N2O5S |
| Molecular Weight | 650.61 g/mol |
| Exact Mass | 650.17 |
| IUPAC Name | 4-(4-cyclopropylphenyl)-2-[2-fluoro-4-(6,6,6-trifluorohexoxy)phenyl]-N-methylsulfonyl-6-oxo-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
| SMILES | CS(=O)(=O)NC(=O)C1=C(c2ccc(C3CC3)cc2)CC(c2ccc(OCCCCCC(F)(F)F)cc2F)(C(F)(F)F)NC1=O |
| InChI | InChI=1S/C29H29F7N2O5S/c1-44(41,42)38-26(40)24-21(19-9-7-18(8-10-19)17-5-6-17)16-27(29(34,35)36,37-25(24)39)22-12-11-20(15-23(22)30)43-14-4-2-3-13-28(31,32)33/h7-12,15,17H,2-6,13-14,16H2,1H3,(H,37,39)(H,38,40) |
| InChIKey | ORZFFKXWQBEOAD-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.61 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|