C29H32F6N2O5S — CID 163476474
(2S)-4-(4-methylphenyl)-6-oxo-N-pentylsulfonyl-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide (PubChem CID 163476474) has the molecular formula C29H32F6N2O5S and a molecular weight of 634.64 g/mol. Its IUPAC name is (2S)-4-(4-methylphenyl)-6-oxo-N-pentylsulfonyl-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide.
| Compound Name | (2S)-4-(4-methylphenyl)-6-oxo-N-pentylsulfonyl-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 163476474 |
| Molecular Formula | C29H32F6N2O5S |
| Molecular Weight | 634.64 g/mol |
| Exact Mass | 634.19 |
| IUPAC Name | (2S)-4-(4-methylphenyl)-6-oxo-N-pentylsulfonyl-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
| SMILES | CCCCCS(=O)(=O)NC(=O)C1=C(c2ccc(C)cc2)C[C@](c2ccc(OCCCC(F)(F)F)cc2)(C(F)(F)F)NC1=O |
| InChI | InChI=1S/C29H32F6N2O5S/c1-3-4-5-17-43(40,41)37-26(39)24-23(20-9-7-19(2)8-10-20)18-27(29(33,34)35,36-25(24)38)21-11-13-22(14-12-21)42-16-6-15-28(30,31)32/h7-14H,3-6,15-18H2,1-2H3,(H,36,38)(H,37,39)/t27-/m0/s1 |
| InChIKey | CAVZTUZARFNYIM-MHZLTWQESA-N |
| XLogP | 6.08 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.64 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|