C30H29F3N2O5S — CID 131975267
(2S)-N-(benzenesulfonyl)-2-methyl-4-(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-1,3-dihydropyridine-5-carboxamide (PubChem CID 131975267) has the molecular formula C30H29F3N2O5S and a molecular weight of 586.63 g/mol. Its IUPAC name is (2S)-N-(benzenesulfonyl)-2-methyl-4-(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-1,3-dihydropyridine-5-carboxamide.
| Compound Name | (2S)-N-(benzenesulfonyl)-2-methyl-4-(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-1,3-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 131975267 |
| Molecular Formula | C30H29F3N2O5S |
| Molecular Weight | 586.63 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | (2S)-N-(benzenesulfonyl)-2-methyl-4-(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-1,3-dihydropyridine-5-carboxamide |
| SMILES | Cc1ccc(C2=C(C(=O)NS(=O)(=O)c3ccccc3)C(=O)N[C@](C)(c3ccc(OCCCC(F)(F)F)cc3)C2)cc1 |
| InChI | InChI=1S/C30H29F3N2O5S/c1-20-9-11-21(12-10-20)25-19-29(2,22-13-15-23(16-14-22)40-18-6-17-30(31,32)33)34-27(36)26(25)28(37)35-41(38,39)24-7-4-3-5-8-24/h3-5,7-16H,6,17-19H2,1-2H3,(H,34,36)(H,35,37)/t29-/m0/s1 |
| InChIKey | DLVXMKMVOVLDOO-LJAQVGFWSA-N |
| XLogP | 5.41 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.63 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|