C25H26F6N4O5S — CID 131975299
(2S)-N-cyclopropylsulfonyl-6-oxo-4-(1H-pyrazol-5-yl)-2-[4-(6,6,6-trifluorohexoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide (PubChem CID 131975299) has the molecular formula C25H26F6N4O5S and a molecular weight of 608.56 g/mol. Its IUPAC name is (2S)-N-cyclopropylsulfonyl-6-oxo-4-(1H-pyrazol-5-yl)-2-[4-(6,6,6-trifluorohexoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide.
| Compound Name | (2S)-N-cyclopropylsulfonyl-6-oxo-4-(1H-pyrazol-5-yl)-2-[4-(6,6,6-trifluorohexoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 131975299 |
| Molecular Formula | C25H26F6N4O5S |
| Molecular Weight | 608.56 g/mol |
| Exact Mass | 608.15 |
| IUPAC Name | (2S)-N-cyclopropylsulfonyl-6-oxo-4-(1H-pyrazol-5-yl)-2-[4-(6,6,6-trifluorohexoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
| SMILES | O=C1N[C@@](c2ccc(OCCCCCC(F)(F)F)cc2)(C(F)(F)F)CC(c2ccn[nH]2)=C1C(=O)NS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C25H26F6N4O5S/c26-24(27,28)11-2-1-3-13-40-16-6-4-15(5-7-16)23(25(29,30)31)14-18(19-10-12-32-34-19)20(21(36)33-23)22(37)35-41(38,39)17-8-9-17/h4-7,10,12,17H,1-3,8-9,11,13-14H2,(H,32,34)(H,33,36)(H,35,37)/t23-/m0/s1 |
| InChIKey | SCDRUHGOZRJMSL-QHCPKHFHSA-N |
| XLogP | 4.25 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|