C29H35F3N4O5S — CID 130453180
(2S)-4-[1-(cyclobutylmethyl)pyrazol-3-yl]-N-cyclopropylsulfonyl-6-oxo-2-[2-[4-(4,4,4-trifluorobutoxy)phenyl]ethyl]-2,3-dihydro-1H-pyridine-5-carboxamide (PubChem CID 130453180) has the molecular formula C29H35F3N4O5S and a molecular weight of 608.68 g/mol. Its IUPAC name is (2S)-4-[1-(cyclobutylmethyl)pyrazol-3-yl]-N-cyclopropylsulfonyl-6-oxo-2-[2-[4-(4,4,4-trifluorobutoxy)phenyl]ethyl]-2,3-dihydro-1H-pyridine-5-carboxamide.
| Compound Name | (2S)-4-[1-(cyclobutylmethyl)pyrazol-3-yl]-N-cyclopropylsulfonyl-6-oxo-2-[2-[4-(4,4,4-trifluorobutoxy)phenyl]ethyl]-2,3-dihydro-1H-pyridine-5-carboxamide |
|---|---|
| PubChem CID | 130453180 |
| Molecular Formula | C29H35F3N4O5S |
| Molecular Weight | 608.68 g/mol |
| Exact Mass | 608.23 |
| IUPAC Name | (2S)-4-[1-(cyclobutylmethyl)pyrazol-3-yl]-N-cyclopropylsulfonyl-6-oxo-2-[2-[4-(4,4,4-trifluorobutoxy)phenyl]ethyl]-2,3-dihydro-1H-pyridine-5-carboxamide |
| SMILES | O=C1N[C@@H](CCc2ccc(OCCCC(F)(F)F)cc2)CC(c2ccn(CC3CCC3)n2)=C1C(=O)NS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C29H35F3N4O5S/c30-29(31,32)14-2-16-41-22-9-6-19(7-10-22)5-8-21-17-24(25-13-15-36(34-25)18-20-3-1-4-20)26(27(37)33-21)28(38)35-42(39,40)23-11-12-23/h6-7,9-10,13,15,20-21,23H,1-5,8,11-12,14,16-18H2,(H,33,37)(H,35,38)/t21-/m0/s1 |
| InChIKey | SYUIPZLUWTVYFG-NRFANRHFSA-N |
| XLogP | 4.29 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.68 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|